C25H28O5 — CID 122444905
7-methoxy-2,4-bis(4-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydrochromen-7-ol (PubChem CID 122444905) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is 7-methoxy-2,4-bis(4-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydrochromen-7-ol.
| Compound Name | 7-methoxy-2,4-bis(4-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydrochromen-7-ol |
|---|---|
| PubChem CID | 122444905 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 7-methoxy-2,4-bis(4-methoxyphenyl)-8-methyl-2,3,4,6-tetrahydrochromen-7-ol |
| SMILES | COc1ccc(C2CC(c3ccc(OC)cc3)C3=CCC(O)(OC)C(C)=C3O2)cc1 |
| InChI | InChI=1S/C25H28O5/c1-16-24-21(13-14-25(16,26)29-4)22(17-5-9-19(27-2)10-6-17)15-23(30-24)18-7-11-20(28-3)12-8-18/h5-13,22-23,26H,14-15H2,1-4H3 |
| InChIKey | VEGDHUJDJCRPOO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|