C12H15ClO3 — CID 100945534
(2R,4S,5S)-5-chloro-2-(4-methoxyphenyl)oxan-4-ol (PubChem CID 100945534) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is (2R,4S,5S)-5-chloro-2-(4-methoxyphenyl)oxan-4-ol.
| Compound Name | (2R,4S,5S)-5-chloro-2-(4-methoxyphenyl)oxan-4-ol |
|---|---|
| PubChem CID | 100945534 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (2R,4S,5S)-5-chloro-2-(4-methoxyphenyl)oxan-4-ol |
| SMILES | COc1ccc([C@H]2C[C@H](O)[C@@H](Cl)CO2)cc1 |
| InChI | InChI=1S/C12H15ClO3/c1-15-9-4-2-8(3-5-9)12-6-11(14)10(13)7-16-12/h2-5,10-12,14H,6-7H2,1H3/t10-,11-,12+/m0/s1 |
| InChIKey | GSIHQEQURZHZDW-SDDRHHMPSA-N |
| XLogP | 2.12 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|