C13H18O3 — CID 134960360
2-[(3R,5S)-5-(4-methoxyphenyl)oxolan-3-yl]ethanol (PubChem CID 134960360) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[(3R,5S)-5-(4-methoxyphenyl)oxolan-3-yl]ethanol.
| Compound Name | 2-[(3R,5S)-5-(4-methoxyphenyl)oxolan-3-yl]ethanol |
|---|---|
| PubChem CID | 134960360 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 2-[(3R,5S)-5-(4-methoxyphenyl)oxolan-3-yl]ethanol |
| SMILES | COc1ccc([C@@H]2C[C@@H](CCO)CO2)cc1 |
| InChI | InChI=1S/C13H18O3/c1-15-12-4-2-11(3-5-12)13-8-10(6-7-14)9-16-13/h2-5,10,13-14H,6-9H2,1H3/t10-,13+/m1/s1 |
| InChIKey | BJZREEQMABJVIW-MFKMUULPSA-N |
| XLogP | 2.16 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |