C19H22O4 — CID 10663083
(2S,4R,5R)-2-(4-methoxyphenyl)-5-phenylmethoxyoxan-4-ol (PubChem CID 10663083) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2S,4R,5R)-2-(4-methoxyphenyl)-5-phenylmethoxyoxan-4-ol.
| Compound Name | (2S,4R,5R)-2-(4-methoxyphenyl)-5-phenylmethoxyoxan-4-ol |
|---|---|
| PubChem CID | 10663083 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (2S,4R,5R)-2-(4-methoxyphenyl)-5-phenylmethoxyoxan-4-ol |
| SMILES | COc1ccc([C@@H]2C[C@@H](O)[C@H](OCc3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C19H22O4/c1-21-16-9-7-15(8-10-16)18-11-17(20)19(13-23-18)22-12-14-5-3-2-4-6-14/h2-10,17-20H,11-13H2,1H3/t17-,18+,19-/m1/s1 |
| InChIKey | XUMFFRQEDGJFNS-CEXWTWQISA-N |
| XLogP | 3.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |