C9H15N5O2 — CID 122445374
1-methyl-3-N-[2-(methylamino)ethyl]pyrazole-3,4-dicarboxamide (PubChem CID 122445374) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 1-methyl-3-N-[2-(methylamino)ethyl]pyrazole-3,4-dicarboxamide.
| Compound Name | 1-methyl-3-N-[2-(methylamino)ethyl]pyrazole-3,4-dicarboxamide |
|---|---|
| PubChem CID | 122445374 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 1-methyl-3-N-[2-(methylamino)ethyl]pyrazole-3,4-dicarboxamide |
| SMILES | CNCCNC(=O)c1nn(C)cc1C(N)=O |
| InChI | InChI=1S/C9H15N5O2/c1-11-3-4-12-9(16)7-6(8(10)15)5-14(2)13-7/h5,11H,3-4H2,1-2H3,(H2,10,15)(H,12,16) |
| InChIKey | VZLGLVRPFMUUJA-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|