C21H13F4N5O3S — CID 122447494
N-[5-[2-(1H-benzimidazol-2-yl)-1,3-benzoxazol-6-yl]-2-fluoro-3-pyridinyl]-2,2,2-trifluoroethanesulfonamide (PubChem CID 122447494) has the molecular formula C21H13F4N5O3S and a molecular weight of 491.43 g/mol. Its IUPAC name is N-[5-[2-(1H-benzimidazol-2-yl)-1,3-benzoxazol-6-yl]-2-fluoro-3-pyridinyl]-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N-[5-[2-(1H-benzimidazol-2-yl)-1,3-benzoxazol-6-yl]-2-fluoro-3-pyridinyl]-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 122447494 |
| Molecular Formula | C21H13F4N5O3S |
| Molecular Weight | 491.43 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-[5-[2-(1H-benzimidazol-2-yl)-1,3-benzoxazol-6-yl]-2-fluoro-3-pyridinyl]-2,2,2-trifluoroethanesulfonamide |
| SMILES | O=S(=O)(CC(F)(F)F)Nc1cc(-c2ccc3nc(-c4nc5ccccc5[nH]4)oc3c2)cnc1F |
| InChI | InChI=1S/C21H13F4N5O3S/c22-18-16(30-34(31,32)10-21(23,24)25)7-12(9-26-18)11-5-6-15-17(8-11)33-20(29-15)19-27-13-3-1-2-4-14(13)28-19/h1-9,30H,10H2,(H,27,28) |
| InChIKey | UJUIEQMTGAYOHY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|