C13H23N9O — CID 122448187
3-[1-[2-(aminodiazenyl)ethyl]imidazol-2-yl]-1-[4-(aminodiazenyl)piperidin-1-yl]propan-1-one (PubChem CID 122448187) has the molecular formula C13H23N9O and a molecular weight of 321.39 g/mol. Its IUPAC name is 3-[1-[2-(aminodiazenyl)ethyl]imidazol-2-yl]-1-[4-(aminodiazenyl)piperidin-1-yl]propan-1-one.
| Compound Name | 3-[1-[2-(aminodiazenyl)ethyl]imidazol-2-yl]-1-[4-(aminodiazenyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 122448187 |
| Molecular Formula | C13H23N9O |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 3-[1-[2-(aminodiazenyl)ethyl]imidazol-2-yl]-1-[4-(aminodiazenyl)piperidin-1-yl]propan-1-one |
| SMILES | N/N=N/CCn1ccnc1CCC(=O)N1CCC(/N=N/N)CC1 |
| InChI | InChI=1S/C13H23N9O/c14-19-17-6-10-21-9-5-16-12(21)1-2-13(23)22-7-3-11(4-8-22)18-20-15/h5,9,11H,1-4,6-8,10H2,(H2,14,17)(H2,15,18) |
| InChIKey | YOLZWMUNBQYHOM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|