C22H27ClN2O — CID 122450616
(3S)-N-[2-(4-chloro-2-phenylphenyl)propan-2-yl]-1-methylpiperidine-3-carboxamide (PubChem CID 122450616) has the molecular formula C22H27ClN2O and a molecular weight of 370.92 g/mol. Its IUPAC name is (3S)-N-[2-(4-chloro-2-phenylphenyl)propan-2-yl]-1-methylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(4-chloro-2-phenylphenyl)propan-2-yl]-1-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 122450616 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (3S)-N-[2-(4-chloro-2-phenylphenyl)propan-2-yl]-1-methylpiperidine-3-carboxamide |
| SMILES | CN1CCC[C@H](C(=O)NC(C)(C)c2ccc(Cl)cc2-c2ccccc2)C1 |
| InChI | InChI=1S/C22H27ClN2O/c1-22(2,24-21(26)17-10-7-13-25(3)15-17)20-12-11-18(23)14-19(20)16-8-5-4-6-9-16/h4-6,8-9,11-12,14,17H,7,10,13,15H2,1-3H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | XMKTXXXPNSSROU-KRWDZBQOSA-N |
| XLogP | 4.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |