C28H33ClN8O5S — CID 122453063
[4-[5-chloro-2-[(2S,4R)-1-[4-(diaminomethylideneamino)benzoyl]-4-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-2-yl]-1H-imidazol-4-yl]phenyl] carbamate (PubChem CID 122453063) has the molecular formula C28H33ClN8O5S and a molecular weight of 629.14 g/mol. Its IUPAC name is [4-[5-chloro-2-[(2S,4R)-1-[4-(diaminomethylideneamino)benzoyl]-4-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-2-yl]-1H-imidazol-4-yl]phenyl] carbamate.
| Compound Name | [4-[5-chloro-2-[(2S,4R)-1-[4-(diaminomethylideneamino)benzoyl]-4-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-2-yl]-1H-imidazol-4-yl]phenyl] carbamate |
|---|---|
| PubChem CID | 122453063 |
| Molecular Formula | C28H33ClN8O5S |
| Molecular Weight | 629.14 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | [4-[5-chloro-2-[(2S,4R)-1-[4-(diaminomethylideneamino)benzoyl]-4-(1-methylsulfonylpiperidin-4-yl)pyrrolidin-2-yl]-1H-imidazol-4-yl]phenyl] carbamate |
| SMILES | CS(=O)(=O)N1CCC([C@H]2C[C@@H](c3nc(-c4ccc(OC(N)=O)cc4)c(Cl)[nH]3)N(C(=O)c3ccc(N=C(N)N)cc3)C2)CC1 |
| InChI | InChI=1S/C28H33ClN8O5S/c1-43(40,41)36-12-10-16(11-13-36)19-14-22(37(15-19)26(38)18-2-6-20(7-3-18)33-27(30)31)25-34-23(24(29)35-25)17-4-8-21(9-5-17)42-28(32)39/h2-9,16,19,22H,10-15H2,1H3,(H2,32,39)(H,34,35)(H4,30,31,33)/t19-,22-/m0/s1 |
| InChIKey | YYHNDHOFERZRSJ-UGKGYDQZSA-N |
| XLogP | 2.97 |
| TPSA | 203.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.14 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|