C11H10F15O6P — CID 122455373
[2,3-difluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl] dimethyl phosphate (PubChem CID 122455373) has the molecular formula C11H10F15O6P and a molecular weight of 554.14 g/mol. Its IUPAC name is [2,3-difluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl] dimethyl phosphate.
| Compound Name | [2,3-difluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl] dimethyl phosphate |
|---|---|
| PubChem CID | 122455373 |
| Molecular Formula | C11H10F15O6P |
| Molecular Weight | 554.14 g/mol |
| Exact Mass | 554.00 |
| IUPAC Name | [2,3-difluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propyl] dimethyl phosphate |
| SMILES | COP(=O)(OC)OCC(F)(CF)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F15O6P/c1-28-33(27,29-2)30-4-5(13,3-12)31-11(25,26)7(16,9(20,21)22)32-10(23,24)6(14,15)8(17,18)19/h3-4H2,1-2H3 |
| InChIKey | GURVEEWYGPIDIR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.14 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|