C7H14F3O6P — CID 657052
[(2R)-1-methoxy-3-(2,2,2-trifluoroethoxy)propan-2-yl] methyl hydrogen phosphate (PubChem CID 657052) has the molecular formula C7H14F3O6P and a molecular weight of 282.15 g/mol. Its IUPAC name is [(2R)-1-methoxy-3-(2,2,2-trifluoroethoxy)propan-2-yl] methyl hydrogen phosphate.
| Compound Name | [(2R)-1-methoxy-3-(2,2,2-trifluoroethoxy)propan-2-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 657052 |
| Molecular Formula | C7H14F3O6P |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | [(2R)-1-methoxy-3-(2,2,2-trifluoroethoxy)propan-2-yl] methyl hydrogen phosphate |
| SMILES | COC[C@H](COCC(F)(F)F)OP(=O)(O)OC |
| InChI | InChI=1S/C7H14F3O6P/c1-13-3-6(16-17(11,12)14-2)4-15-5-7(8,9)10/h6H,3-5H2,1-2H3,(H,11,12)/t6-/m1/s1 |
| InChIKey | SWDUFSSEYPDFHH-ZCFIWIBFSA-N |
| XLogP | 1.34 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|