C15H13BrN4 — CID 122457563
4-bromo-6-[(pyridin-4-ylamino)methyl]isoquinolin-3-amine (PubChem CID 122457563) has the molecular formula C15H13BrN4 and a molecular weight of 329.20 g/mol. Its IUPAC name is 4-bromo-6-[(pyridin-4-ylamino)methyl]isoquinolin-3-amine.
| Compound Name | 4-bromo-6-[(pyridin-4-ylamino)methyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 122457563 |
| Molecular Formula | C15H13BrN4 |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 4-bromo-6-[(pyridin-4-ylamino)methyl]isoquinolin-3-amine |
| SMILES | Nc1ncc2ccc(CNc3ccncc3)cc2c1Br |
| InChI | InChI=1S/C15H13BrN4/c16-14-13-7-10(1-2-11(13)9-20-15(14)17)8-19-12-3-5-18-6-4-12/h1-7,9H,8H2,(H2,17,20)(H,18,19) |
| InChIKey | OGJHFFDEYURCPU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |