C17H23FN2O2 — CID 122457821
(2S)-2-amino-5-[[(2S)-2-(4-fluorophenyl)cyclopropyl]-prop-2-enylamino]pentanoic acid (PubChem CID 122457821) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(2S)-2-(4-fluorophenyl)cyclopropyl]-prop-2-enylamino]pentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(2S)-2-(4-fluorophenyl)cyclopropyl]-prop-2-enylamino]pentanoic acid |
|---|---|
| PubChem CID | 122457821 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2S)-2-amino-5-[[(2S)-2-(4-fluorophenyl)cyclopropyl]-prop-2-enylamino]pentanoic acid |
| SMILES | C=CCN(CCC[C@H](N)C(=O)O)C1C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H23FN2O2/c1-2-9-20(10-3-4-15(19)17(21)22)16-11-14(16)12-5-7-13(18)8-6-12/h2,5-8,14-16H,1,3-4,9-11,19H2,(H,21,22)/t14-,15-,16?/m0/s1 |
| InChIKey | IBHDVHVTSKRPBO-KSCSMHSMSA-N |
| XLogP | 2.36 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|