C26H28FN5O3 — CID 122460499
(2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-prop-2-enylamino]-2-[N-formyl-4-(triazol-1-yl)anilino]pentanoic acid (PubChem CID 122460499) has the molecular formula C26H28FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is (2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-prop-2-enylamino]-2-[N-formyl-4-(triazol-1-yl)anilino]pentanoic acid.
| Compound Name | (2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-prop-2-enylamino]-2-[N-formyl-4-(triazol-1-yl)anilino]pentanoic acid |
|---|---|
| PubChem CID | 122460499 |
| Molecular Formula | C26H28FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (2S)-5-[[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-prop-2-enylamino]-2-[N-formyl-4-(triazol-1-yl)anilino]pentanoic acid |
| SMILES | C=CCN(CCC[C@@H](C(=O)O)N(C=O)c1ccc(-n2ccnn2)cc1)[C@@H]1C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28FN5O3/c1-2-14-30(25-17-23(25)19-5-7-20(27)8-6-19)15-3-4-24(26(34)35)31(18-33)21-9-11-22(12-10-21)32-16-13-28-29-32/h2,5-13,16,18,23-25H,1,3-4,14-15,17H2,(H,34,35)/t23-,24-,25+/m0/s1 |
| InChIKey | DIVNROSRYFJCFH-CCDWMCETSA-N |
| XLogP | 3.65 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|