C9H16N2O3 — CID 122458449
2-(1-methyl-2-oxopiperidin-4-yl)ethylcarbamic acid (PubChem CID 122458449) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-(1-methyl-2-oxopiperidin-4-yl)ethylcarbamic acid.
| Compound Name | 2-(1-methyl-2-oxopiperidin-4-yl)ethylcarbamic acid |
|---|---|
| PubChem CID | 122458449 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-(1-methyl-2-oxopiperidin-4-yl)ethylcarbamic acid |
| SMILES | CN1CCC(CCNC(=O)O)CC1=O |
| InChI | InChI=1S/C9H16N2O3/c1-11-5-3-7(6-8(11)12)2-4-10-9(13)14/h7,10H,2-6H2,1H3,(H,13,14) |
| InChIKey | KFZJWLNQZTWIJY-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |