C15H24N2O3 — CID 122459701
(2S)-5-(1-adamantylamino)-2-amino-5-oxopentanoic acid (PubChem CID 122459701) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is (2S)-5-(1-adamantylamino)-2-amino-5-oxopentanoic acid.
| Compound Name | (2S)-5-(1-adamantylamino)-2-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 122459701 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | (2S)-5-(1-adamantylamino)-2-amino-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)NC12CC3CC(CC(C3)C1)C2)C(=O)O |
| InChI | InChI=1S/C15H24N2O3/c16-12(14(19)20)1-2-13(18)17-15-6-9-3-10(7-15)5-11(4-9)8-15/h9-12H,1-8,16H2,(H,17,18)(H,19,20)/t9?,10?,11?,12-,15?/m0/s1 |
| InChIKey | ZCFVVCBZPPSGOS-ONTFQQAWSA-N |
| XLogP | 1.26 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |