C17H15F6N3O2 — CID 122461205
[4-[[(1S,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropyl]methoxy]-3-(trifluoromethyl)-2-pyridinyl]hydrazine (PubChem CID 122461205) has the molecular formula C17H15F6N3O2 and a molecular weight of 407.31 g/mol. Its IUPAC name is [4-[[(1S,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropyl]methoxy]-3-(trifluoromethyl)-2-pyridinyl]hydrazine.
| Compound Name | [4-[[(1S,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropyl]methoxy]-3-(trifluoromethyl)-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 122461205 |
| Molecular Formula | C17H15F6N3O2 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [4-[[(1S,2S)-2-[2-(trifluoromethoxy)phenyl]cyclopropyl]methoxy]-3-(trifluoromethyl)-2-pyridinyl]hydrazine |
| SMILES | NNc1nccc(OC[C@H]2C[C@@H]2c2ccccc2OC(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C17H15F6N3O2/c18-16(19,20)14-13(5-6-25-15(14)26-24)27-8-9-7-11(9)10-3-1-2-4-12(10)28-17(21,22)23/h1-6,9,11H,7-8,24H2,(H,25,26)/t9-,11+/m1/s1 |
| InChIKey | PAJFKTQQERICPY-KOLCDFICSA-N |
| XLogP | 4.47 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|