C17H14ClF4NO2 — CID 122461203
2-chloro-4-[[(1S,2S)-2-(2-fluoro-6-methoxyphenyl)cyclopropyl]methoxy]-3-(trifluoromethyl)pyridine (PubChem CID 122461203) has the molecular formula C17H14ClF4NO2 and a molecular weight of 375.75 g/mol. Its IUPAC name is 2-chloro-4-[[(1S,2S)-2-(2-fluoro-6-methoxyphenyl)cyclopropyl]methoxy]-3-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-4-[[(1S,2S)-2-(2-fluoro-6-methoxyphenyl)cyclopropyl]methoxy]-3-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 122461203 |
| Molecular Formula | C17H14ClF4NO2 |
| Molecular Weight | 375.75 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2-chloro-4-[[(1S,2S)-2-(2-fluoro-6-methoxyphenyl)cyclopropyl]methoxy]-3-(trifluoromethyl)pyridine |
| SMILES | COc1cccc(F)c1[C@H]1C[C@@H]1COc1ccnc(Cl)c1C(F)(F)F |
| InChI | InChI=1S/C17H14ClF4NO2/c1-24-12-4-2-3-11(19)14(12)10-7-9(10)8-25-13-5-6-23-16(18)15(13)17(20,21)22/h2-6,9-10H,7-8H2,1H3/t9-,10+/m1/s1 |
| InChIKey | BQFDKSHLTOWJGM-ZJUUUORDSA-N |
| XLogP | 5.08 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.75 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|