C17H11ClF4N2O — CID 122461213
3-[[2-chloro-3-(trifluoromethyl)-4-pyridinyl]oxy]-1-(4-fluorophenyl)cyclobutane-1-carbonitrile (PubChem CID 122461213) has the molecular formula C17H11ClF4N2O and a molecular weight of 370.73 g/mol. Its IUPAC name is 3-[[2-chloro-3-(trifluoromethyl)-4-pyridinyl]oxy]-1-(4-fluorophenyl)cyclobutane-1-carbonitrile.
| Compound Name | 3-[[2-chloro-3-(trifluoromethyl)-4-pyridinyl]oxy]-1-(4-fluorophenyl)cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 122461213 |
| Molecular Formula | C17H11ClF4N2O |
| Molecular Weight | 370.73 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 3-[[2-chloro-3-(trifluoromethyl)-4-pyridinyl]oxy]-1-(4-fluorophenyl)cyclobutane-1-carbonitrile |
| SMILES | N#CC1(c2ccc(F)cc2)CC(Oc2ccnc(Cl)c2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H11ClF4N2O/c18-15-14(17(20,21)22)13(5-6-24-15)25-12-7-16(8-12,9-23)10-1-3-11(19)4-2-10/h1-6,12H,7-8H2 |
| InChIKey | QRPQUDCRVQMQDX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.73 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|