C19H18F3N5O4S — CID 122468049
(2R,4S,5R)-2-[(2-amino-4-pyridinyl)sulfanyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol (PubChem CID 122468049) has the molecular formula C19H18F3N5O4S and a molecular weight of 469.45 g/mol. Its IUPAC name is (2R,4S,5R)-2-[(2-amino-4-pyridinyl)sulfanyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol.
| Compound Name | (2R,4S,5R)-2-[(2-amino-4-pyridinyl)sulfanyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
|---|---|
| PubChem CID | 122468049 |
| Molecular Formula | C19H18F3N5O4S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | (2R,4S,5R)-2-[(2-amino-4-pyridinyl)sulfanyl]-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxane-3,5-diol |
| SMILES | Nc1cc(S[C@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)C2O)ccn1 |
| InChI | InChI=1S/C19H18F3N5O4S/c20-10-3-8(4-11(21)15(10)22)12-6-27(26-25-12)16-17(29)13(7-28)31-19(18(16)30)32-9-1-2-24-14(23)5-9/h1-6,13,16-19,28-30H,7H2,(H2,23,24)/t13?,16-,17-,18?,19+/m0/s1 |
| InChIKey | CNCPFBXBHYHDIE-DMEOBCPMSA-N |
| XLogP | 1.11 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|