C20H18F3N5O5S — CID 122468009
5-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carboxamide (PubChem CID 122468009) has the molecular formula C20H18F3N5O5S and a molecular weight of 497.46 g/mol. Its IUPAC name is 5-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carboxamide.
| Compound Name | 5-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 122468009 |
| Molecular Formula | C20H18F3N5O5S |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 5-[(2R,4S,5R)-3,5-dihydroxy-6-(hydroxymethyl)-4-[4-(3,4,5-trifluorophenyl)triazol-1-yl]oxan-2-yl]sulfanylpyridine-2-carboxamide |
| SMILES | NC(=O)c1ccc(S[C@H]2OC(CO)[C@H](O)[C@H](n3cc(-c4cc(F)c(F)c(F)c4)nn3)C2O)cn1 |
| InChI | InChI=1S/C20H18F3N5O5S/c21-10-3-8(4-11(22)15(10)23)13-6-28(27-26-13)16-17(30)14(7-29)33-20(18(16)31)34-9-1-2-12(19(24)32)25-5-9/h1-6,14,16-18,20,29-31H,7H2,(H2,24,32)/t14?,16-,17-,18?,20+/m0/s1 |
| InChIKey | HJGKFPDIVJCQPV-HUVWXIPXSA-N |
| XLogP | 0.63 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|