C29H40N8O5 — CID 122472113
tert-butyl 4-[4-amino-3-[6-[4-(6-formyloxy-2-pyridinyl)pyrazol-1-yl]hexylcarbamoyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 122472113) has the molecular formula C29H40N8O5 and a molecular weight of 580.69 g/mol. Its IUPAC name is tert-butyl 4-[4-amino-3-[6-[4-(6-formyloxy-2-pyridinyl)pyrazol-1-yl]hexylcarbamoyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-amino-3-[6-[4-(6-formyloxy-2-pyridinyl)pyrazol-1-yl]hexylcarbamoyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122472113 |
| Molecular Formula | C29H40N8O5 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | tert-butyl 4-[4-amino-3-[6-[4-(6-formyloxy-2-pyridinyl)pyrazol-1-yl]hexylcarbamoyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(N)c(C(=O)NCCCCCCn3cc(-c4cccc(OC=O)n4)cn3)n2)CC1 |
| InChI | InChI=1S/C29H40N8O5/c1-29(2,3)42-28(40)35-15-11-22(12-16-35)37-19-23(30)26(34-37)27(39)31-13-6-4-5-7-14-36-18-21(17-32-36)24-9-8-10-25(33-24)41-20-38/h8-10,17-20,22H,4-7,11-16,30H2,1-3H3,(H,31,39) |
| InChIKey | KHSMXXPOUJEEAD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|