C20H27ClN4O2 — CID 170548355
tert-butyl N-[3-[3-[4-(6-chloro-2-pyridinyl)pyrazol-1-yl]cyclobutyl]propyl]carbamate (PubChem CID 170548355) has the molecular formula C20H27ClN4O2 and a molecular weight of 390.92 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[4-(6-chloro-2-pyridinyl)pyrazol-1-yl]cyclobutyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[4-(6-chloro-2-pyridinyl)pyrazol-1-yl]cyclobutyl]propyl]carbamate |
|---|---|
| PubChem CID | 170548355 |
| Molecular Formula | C20H27ClN4O2 |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | tert-butyl N-[3-[3-[4-(6-chloro-2-pyridinyl)pyrazol-1-yl]cyclobutyl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC1CC(n2cc(-c3cccc(Cl)n3)cn2)C1 |
| InChI | InChI=1S/C20H27ClN4O2/c1-20(2,3)27-19(26)22-9-5-6-14-10-16(11-14)25-13-15(12-23-25)17-7-4-8-18(21)24-17/h4,7-8,12-14,16H,5-6,9-11H2,1-3H3,(H,22,26) |
| InChIKey | UATPBHXPMDGJIQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|