C14H19Cl2NO — CID 122473385
cis-(1S,2S)-2-(1-aminoethyl)-2-(3,4-dichlorophenyl)cyclohexan-1-ol (PubChem CID 122473385) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is cis-(1S,2S)-2-(1-aminoethyl)-2-(3,4-dichlorophenyl)cyclohexan-1-ol.
| Compound Name | cis-(1S,2S)-2-(1-aminoethyl)-2-(3,4-dichlorophenyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 122473385 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | cis-(1S,2S)-2-(1-aminoethyl)-2-(3,4-dichlorophenyl)cyclohexan-1-ol |
| SMILES | CC(N)[C@@]1(c2ccc(Cl)c(Cl)c2)CCCC[C@@H]1O |
| InChI | InChI=1S/C14H19Cl2NO/c1-9(17)14(7-3-2-4-13(14)18)10-5-6-11(15)12(16)8-10/h5-6,8-9,13,18H,2-4,7,17H2,1H3/t9?,13-,14+/m0/s1 |
| InChIKey | UNCQYINMLXKNTE-VOPCEASESA-N |
| XLogP | 3.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |