C6H8F9NO3S — CID 122481999
dimethylazanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 122481999) has the molecular formula C6H8F9NO3S and a molecular weight of 345.18 g/mol. Its IUPAC name is dimethylazanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | dimethylazanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 122481999 |
| Molecular Formula | C6H8F9NO3S |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | dimethylazanium;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF9O3S.C2H7N/c5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16;1-3-2/h(H,14,15,16);3H,1-2H3 |
| InChIKey | JVHIXLULGCKREG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|