C6H14F3NO3S — CID 134207328
dimethylazanium;4,4,4-trifluorobutane-1-sulfonate (PubChem CID 134207328) has the molecular formula C6H14F3NO3S and a molecular weight of 237.24 g/mol. Its IUPAC name is dimethylazanium;4,4,4-trifluorobutane-1-sulfonate.
| Compound Name | dimethylazanium;4,4,4-trifluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 134207328 |
| Molecular Formula | C6H14F3NO3S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | dimethylazanium;4,4,4-trifluorobutane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCC(F)(F)F |
| InChI | InChI=1S/C4H7F3O3S.C2H7N/c5-4(6,7)2-1-3-11(8,9)10;1-3-2/h1-3H2,(H,8,9,10);3H,1-2H3 |
| InChIKey | GNVVEOZWIOCDPY-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|