C10H22F3NO3S — CID 134206296
dimethylazanium;8,8,8-trifluorooctane-1-sulfonate (PubChem CID 134206296) has the molecular formula C10H22F3NO3S and a molecular weight of 293.35 g/mol. Its IUPAC name is dimethylazanium;8,8,8-trifluorooctane-1-sulfonate.
| Compound Name | dimethylazanium;8,8,8-trifluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 134206296 |
| Molecular Formula | C10H22F3NO3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | dimethylazanium;8,8,8-trifluorooctane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCCCCC(F)(F)F |
| InChI | InChI=1S/C8H15F3O3S.C2H7N/c9-8(10,11)6-4-2-1-3-5-7-15(12,13)14;1-3-2/h1-7H2,(H,12,13,14);3H,1-2H3 |
| InChIKey | VWTJABHTNIGZHL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|