C7H17F2NO3S — CID 134206531
5,5-difluoropentane-1-sulfonate;dimethylazanium (PubChem CID 134206531) has the molecular formula C7H17F2NO3S and a molecular weight of 233.28 g/mol. Its IUPAC name is 5,5-difluoropentane-1-sulfonate;dimethylazanium.
| Compound Name | 5,5-difluoropentane-1-sulfonate;dimethylazanium |
|---|---|
| PubChem CID | 134206531 |
| Molecular Formula | C7H17F2NO3S |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 5,5-difluoropentane-1-sulfonate;dimethylazanium |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCC(F)F |
| InChI | InChI=1S/C5H10F2O3S.C2H7N/c6-5(7)3-1-2-4-11(8,9)10;1-3-2/h5H,1-4H2,(H,8,9,10);3H,1-2H3 |
| InChIKey | QLFHMSKJKODJBX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|