C8H18F3NO3S — CID 134206981
dimethylazanium;6,6,6-trifluorohexane-1-sulfonate (PubChem CID 134206981) has the molecular formula C8H18F3NO3S and a molecular weight of 265.30 g/mol. Its IUPAC name is dimethylazanium;6,6,6-trifluorohexane-1-sulfonate.
| Compound Name | dimethylazanium;6,6,6-trifluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 134206981 |
| Molecular Formula | C8H18F3NO3S |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | dimethylazanium;6,6,6-trifluorohexane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCCC(F)(F)F |
| InChI | InChI=1S/C6H11F3O3S.C2H7N/c7-6(8,9)4-2-1-3-5-13(10,11)12;1-3-2/h1-5H2,(H,10,11,12);3H,1-2H3 |
| InChIKey | AXHHAUXBZBVSTH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|