C12H26F3NO3S — CID 134206587
dimethylazanium;10,10,10-trifluorodecane-1-sulfonate (PubChem CID 134206587) has the molecular formula C12H26F3NO3S and a molecular weight of 321.41 g/mol. Its IUPAC name is dimethylazanium;10,10,10-trifluorodecane-1-sulfonate.
| Compound Name | dimethylazanium;10,10,10-trifluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 134206587 |
| Molecular Formula | C12H26F3NO3S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | dimethylazanium;10,10,10-trifluorodecane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C10H19F3O3S.C2H7N/c11-10(12,13)8-6-4-2-1-3-5-7-9-17(14,15)16;1-3-2/h1-9H2,(H,14,15,16);3H,1-2H3 |
| InChIKey | RGMKKRNKBQFEGH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|