C9H20F3NO3S — CID 134206582
dimethylazanium;7,7,7-trifluoroheptane-1-sulfonate (PubChem CID 134206582) has the molecular formula C9H20F3NO3S and a molecular weight of 279.32 g/mol. Its IUPAC name is dimethylazanium;7,7,7-trifluoroheptane-1-sulfonate.
| Compound Name | dimethylazanium;7,7,7-trifluoroheptane-1-sulfonate |
|---|---|
| PubChem CID | 134206582 |
| Molecular Formula | C9H20F3NO3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | dimethylazanium;7,7,7-trifluoroheptane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCCCC(F)(F)F |
| InChI | InChI=1S/C7H13F3O3S.C2H7N/c8-7(9,10)5-3-1-2-4-6-14(11,12)13;1-3-2/h1-6H2,(H,11,12,13);3H,1-2H3 |
| InChIKey | NEKWDRVOXAKSKD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|