C7H16F3NO3S — CID 134206896
dimethylazanium;5,5,5-trifluoropentane-1-sulfonate (PubChem CID 134206896) has the molecular formula C7H16F3NO3S and a molecular weight of 251.27 g/mol. Its IUPAC name is dimethylazanium;5,5,5-trifluoropentane-1-sulfonate.
| Compound Name | dimethylazanium;5,5,5-trifluoropentane-1-sulfonate |
|---|---|
| PubChem CID | 134206896 |
| Molecular Formula | C7H16F3NO3S |
| Molecular Weight | 251.27 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | dimethylazanium;5,5,5-trifluoropentane-1-sulfonate |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCC(F)(F)F |
| InChI | InChI=1S/C5H9F3O3S.C2H7N/c6-5(7,8)3-1-2-4-12(9,10)11;1-3-2/h1-4H2,(H,9,10,11);3H,1-2H3 |
| InChIKey | YXZUUBUCCFYPMS-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|