C8H19F2NO3S — CID 134207371
6,6-difluorohexane-1-sulfonate;dimethylazanium (PubChem CID 134207371) has the molecular formula C8H19F2NO3S and a molecular weight of 247.31 g/mol. Its IUPAC name is 6,6-difluorohexane-1-sulfonate;dimethylazanium.
| Compound Name | 6,6-difluorohexane-1-sulfonate;dimethylazanium |
|---|---|
| PubChem CID | 134207371 |
| Molecular Formula | C8H19F2NO3S |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 6,6-difluorohexane-1-sulfonate;dimethylazanium |
| SMILES | C[NH2+]C.O=S(=O)([O-])CCCCCC(F)F |
| InChI | InChI=1S/C6H12F2O3S.C2H7N/c7-6(8)4-2-1-3-5-12(9,10)11;1-3-2/h6H,1-5H2,(H,9,10,11);3H,1-2H3 |
| InChIKey | AAEHSYQQFKYFSY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|