C10H7NO4 — CID 122483610
1,3-dioxo-4H-isoquinoline-7-carboxylic acid (PubChem CID 122483610) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 1,3-dioxo-4H-isoquinoline-7-carboxylic acid.
| Compound Name | 1,3-dioxo-4H-isoquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 122483610 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 1,3-dioxo-4H-isoquinoline-7-carboxylic acid |
| SMILES | O=C1Cc2ccc(C(=O)O)cc2C(=O)N1 |
| InChI | InChI=1S/C10H7NO4/c12-8-4-5-1-2-6(10(14)15)3-7(5)9(13)11-8/h1-3H,4H2,(H,14,15)(H,11,12,13) |
| InChIKey | ROWDWMZXFXQXCW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|