C21H23NO4 — CID 122488304
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2S)-2-hydroxy-2-(3-hydroxyphenyl)-2-phenylacetate (PubChem CID 122488304) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2S)-2-hydroxy-2-(3-hydroxyphenyl)-2-phenylacetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2S)-2-hydroxy-2-(3-hydroxyphenyl)-2-phenylacetate |
|---|---|
| PubChem CID | 122488304 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] (2S)-2-hydroxy-2-(3-hydroxyphenyl)-2-phenylacetate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)[C@](O)(c1ccccc1)c1cccc(O)c1 |
| InChI | InChI=1S/C21H23NO4/c23-18-8-4-7-17(13-18)21(25,16-5-2-1-3-6-16)20(24)26-19-14-22-11-9-15(19)10-12-22/h1-8,13,15,19,23,25H,9-12,14H2/t19-,21-/m0/s1 |
| InChIKey | GKQZEAQMHWWUML-FPOVZHCZSA-N |
| XLogP | 2.27 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |