C29H35NO7 — CID 141491721
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[3-[4-(1,3-dioxol-2-yl)butoxy]phenyl]-2-hydroxy-2-(4-methoxyphenyl)acetate (PubChem CID 141491721) has the molecular formula C29H35NO7 and a molecular weight of 509.60 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[3-[4-(1,3-dioxol-2-yl)butoxy]phenyl]-2-hydroxy-2-(4-methoxyphenyl)acetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[3-[4-(1,3-dioxol-2-yl)butoxy]phenyl]-2-hydroxy-2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 141491721 |
| Molecular Formula | C29H35NO7 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[3-[4-(1,3-dioxol-2-yl)butoxy]phenyl]-2-hydroxy-2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(C(O)(C(=O)O[C@H]2CN3CCC2CC3)c2cccc(OCCCCC3OC=CO3)c2)cc1 |
| InChI | InChI=1S/C29H35NO7/c1-33-24-10-8-22(9-11-24)29(32,28(31)37-26-20-30-14-12-21(26)13-15-30)23-5-4-6-25(19-23)34-16-3-2-7-27-35-17-18-36-27/h4-6,8-11,17-19,21,26-27,32H,2-3,7,12-16,20H2,1H3/t26-,29?/m0/s1 |
| InChIKey | CEURYXZDXLTZKU-QUWDGAPNSA-N |
| XLogP | 3.96 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|