C21H22O6 — CID 141491729
(2S)-2-[3-[4-(1,3-dioxol-2-yl)butoxy]phenyl]-2-hydroxy-2-phenylacetic acid (PubChem CID 141491729) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is (2S)-2-[3-[4-(1,3-dioxol-2-yl)butoxy]phenyl]-2-hydroxy-2-phenylacetic acid.
| Compound Name | (2S)-2-[3-[4-(1,3-dioxol-2-yl)butoxy]phenyl]-2-hydroxy-2-phenylacetic acid |
|---|---|
| PubChem CID | 141491729 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2S)-2-[3-[4-(1,3-dioxol-2-yl)butoxy]phenyl]-2-hydroxy-2-phenylacetic acid |
| SMILES | O=C(O)[C@](O)(c1ccccc1)c1cccc(OCCCCC2OC=CO2)c1 |
| InChI | InChI=1S/C21H22O6/c22-20(23)21(24,16-7-2-1-3-8-16)17-9-6-10-18(15-17)25-12-5-4-11-19-26-13-14-27-19/h1-3,6-10,13-15,19,24H,4-5,11-12H2,(H,22,23)/t21-/m0/s1 |
| InChIKey | PPGJOUBOXUFVOJ-NRFANRHFSA-N |
| XLogP | 3.40 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|