C29H36Cl2N2O4 — CID 131749206
(1-benzylpiperidin-4-yl) (2S)-2-[3-(3-aminopropoxy)phenyl]-2-hydroxy-2-phenylacetate;dihydrochloride (PubChem CID 131749206) has the molecular formula C29H36Cl2N2O4 and a molecular weight of 547.52 g/mol. Its IUPAC name is (1-benzylpiperidin-4-yl) (2S)-2-[3-(3-aminopropoxy)phenyl]-2-hydroxy-2-phenylacetate;dihydrochloride.
| Compound Name | (1-benzylpiperidin-4-yl) (2S)-2-[3-(3-aminopropoxy)phenyl]-2-hydroxy-2-phenylacetate;dihydrochloride |
|---|---|
| PubChem CID | 131749206 |
| Molecular Formula | C29H36Cl2N2O4 |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | (1-benzylpiperidin-4-yl) (2S)-2-[3-(3-aminopropoxy)phenyl]-2-hydroxy-2-phenylacetate;dihydrochloride |
| SMILES | Cl.Cl.NCCCOc1cccc([C@](O)(C(=O)OC2CCN(Cc3ccccc3)CC2)c2ccccc2)c1 |
| InChI | InChI=1S/C29H34N2O4.2ClH/c30-17-8-20-34-27-14-7-13-25(21-27)29(33,24-11-5-2-6-12-24)28(32)35-26-15-18-31(19-16-26)22-23-9-3-1-4-10-23;;/h1-7,9-14,21,26,33H,8,15-20,22,30H2;2*1H/t29-;;/m0../s1 |
| InChIKey | USRDUNPVQBLOGO-UJXPALLWSA-N |
| XLogP | 4.70 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|