About 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane
4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane (PubChem CID 145136004) has the molecular formula C30H42O7
and a molecular weight of 514.66 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane.
Molecular Properties
| Compound Name | 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane |
| PubChem CID | 145136004 |
| Molecular Formula | C30H42O7 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane |
| SMILES | CC.O=C(OCCCCC1OCCO1)C(c1ccccc1)c1cccc(OCCCCC2OCCO2)c1 |
| InChI | InChI=1S/C28H36O7.C2H6/c29-28(35-16-7-5-14-26-33-19-20-34-26)27(22-9-2-1-3-10-22)23-11-8-12-24(21-23)30-15-6-4-13-25-31-17-18-32-25;1-2/h1-3,8-12,21,25-27H,4-7,13-20H2;1-2H3 |
| InChIKey | SRBKMNSQCXELKB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane?
The IUPAC name of 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane (CID 145136004) is 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane.
What is the SMILES notation for 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane?
The canonical SMILES for 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane is CC.O=C(OCCCCC1OCCO1)C(c1ccccc1)c1cccc(OCCCCC2OCCO2)c1.
What is the InChIKey of 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane?
The InChIKey is SRBKMNSQCXELKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H36O7.C2H6/c29-28(35-16-7-5-14-26-33-19-20-34-26)27(22-9-2-1-3-10-22)23-11-8-12-24(21-23)30-15-6-4-13-25-31-17-18-32-25;1-2/h1-3,8-12,21,25-27H,4-7,13-20H2;1-2H3.
What are the key properties of 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane?
4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane has a molecular weight of 514.66 g/mol, XLogP of 5.85, 14 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-dioxolan-2-yl)butyl 2-[3-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-phenylacetate;ethane is sourced from PubChem (CID 145136004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).