C24H27NO6 — CID 129167885
1-[3-[4-(1,3-dioxolan-2-yl)butoxy]benzoyl]-3-phenylazetidine-3-carboxylic acid (PubChem CID 129167885) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is 1-[3-[4-(1,3-dioxolan-2-yl)butoxy]benzoyl]-3-phenylazetidine-3-carboxylic acid.
| Compound Name | 1-[3-[4-(1,3-dioxolan-2-yl)butoxy]benzoyl]-3-phenylazetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 129167885 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-[3-[4-(1,3-dioxolan-2-yl)butoxy]benzoyl]-3-phenylazetidine-3-carboxylic acid |
| SMILES | O=C(c1cccc(OCCCCC2OCCO2)c1)N1CC(C(=O)O)(c2ccccc2)C1 |
| InChI | InChI=1S/C24H27NO6/c26-22(25-16-24(17-25,23(27)28)19-8-2-1-3-9-19)18-7-6-10-20(15-18)29-12-5-4-11-21-30-13-14-31-21/h1-3,6-10,15,21H,4-5,11-14,16-17H2,(H,27,28) |
| InChIKey | LMDCHYZWKYTSOF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|