C24H30N4O4 — CID 125023014
(3R)-1-[3-(2-morpholin-4-ylethoxy)benzoyl]-3-pyridin-2-ylpiperidine-3-carboxamide (PubChem CID 125023014) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is (3R)-1-[3-(2-morpholin-4-ylethoxy)benzoyl]-3-pyridin-2-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[3-(2-morpholin-4-ylethoxy)benzoyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 125023014 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | (3R)-1-[3-(2-morpholin-4-ylethoxy)benzoyl]-3-pyridin-2-ylpiperidine-3-carboxamide |
| SMILES | NC(=O)[C@]1(c2ccccn2)CCCN(C(=O)c2cccc(OCCN3CCOCC3)c2)C1 |
| InChI | InChI=1S/C24H30N4O4/c25-23(30)24(21-7-1-2-9-26-21)8-4-10-28(18-24)22(29)19-5-3-6-20(17-19)32-16-13-27-11-14-31-15-12-27/h1-3,5-7,9,17H,4,8,10-16,18H2,(H2,25,30)/t24-/m1/s1 |
| InChIKey | YUXVREZGPBREGL-XMMPIXPASA-N |
| XLogP | 1.45 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |