C22H26O6 — CID 122455577
methyl 2-[4-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-hydroxy-2-phenylacetate (PubChem CID 122455577) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is methyl 2-[4-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-hydroxy-2-phenylacetate.
| Compound Name | methyl 2-[4-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 122455577 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | methyl 2-[4-[4-(1,3-dioxolan-2-yl)butoxy]phenyl]-2-hydroxy-2-phenylacetate |
| SMILES | COC(=O)C(O)(c1ccccc1)c1ccc(OCCCCC2OCCO2)cc1 |
| InChI | InChI=1S/C22H26O6/c1-25-21(23)22(24,17-7-3-2-4-8-17)18-10-12-19(13-11-18)26-14-6-5-9-20-27-15-16-28-20/h2-4,7-8,10-13,20,24H,5-6,9,14-16H2,1H3 |
| InChIKey | MWOVRVYNVGNAJH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|