C35H40N2O7 — CID 122461649
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[3-[[4-[4-(1,3-dioxolan-2-yl)butoxy]benzoyl]amino]phenyl]-2-hydroxy-2-phenylacetate (PubChem CID 122461649) has the molecular formula C35H40N2O7 and a molecular weight of 600.71 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[3-[[4-[4-(1,3-dioxolan-2-yl)butoxy]benzoyl]amino]phenyl]-2-hydroxy-2-phenylacetate.
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[3-[[4-[4-(1,3-dioxolan-2-yl)butoxy]benzoyl]amino]phenyl]-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 122461649 |
| Molecular Formula | C35H40N2O7 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 2-[3-[[4-[4-(1,3-dioxolan-2-yl)butoxy]benzoyl]amino]phenyl]-2-hydroxy-2-phenylacetate |
| SMILES | O=C(Nc1cccc(C(O)(C(=O)O[C@H]2CN3CCC2CC3)c2ccccc2)c1)c1ccc(OCCCCC2OCCO2)cc1 |
| InChI | InChI=1S/C35H40N2O7/c38-33(26-12-14-30(15-13-26)41-20-5-4-11-32-42-21-22-43-32)36-29-10-6-9-28(23-29)35(40,27-7-2-1-3-8-27)34(39)44-31-24-37-18-16-25(31)17-19-37/h1-3,6-10,12-15,23,25,31-32,40H,4-5,11,16-22,24H2,(H,36,38)/t31-,35?/m0/s1 |
| InChIKey | QDRIMNYRMMWMFJ-MWGAKABSSA-N |
| XLogP | 4.73 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|