C27H29N3O3 — CID 122495133
tert-butyl 4-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperazine-1-carboxylate (PubChem CID 122495133) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is tert-butyl 4-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122495133 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | tert-butyl 4-[[4-(1-benzofuran-2-yl)isoquinolin-6-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc3cncc(-c4cc5ccccc5o4)c3c2)CC1 |
| InChI | InChI=1S/C27H29N3O3/c1-27(2,3)33-26(31)30-12-10-29(11-13-30)18-19-8-9-21-16-28-17-23(22(21)14-19)25-15-20-6-4-5-7-24(20)32-25/h4-9,14-17H,10-13,18H2,1-3H3 |
| InChIKey | LNCZWKJCZGXPDG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |