C29H31N3O5 — CID 159987165
tert-butyl 2-[1-[[4-(1-benzofuran-2-yl)-7-nitroisoquinolin-6-yl]methyl]piperidin-4-yl]acetate (PubChem CID 159987165) has the molecular formula C29H31N3O5 and a molecular weight of 501.58 g/mol. Its IUPAC name is tert-butyl 2-[1-[[4-(1-benzofuran-2-yl)-7-nitroisoquinolin-6-yl]methyl]piperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[1-[[4-(1-benzofuran-2-yl)-7-nitroisoquinolin-6-yl]methyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 159987165 |
| Molecular Formula | C29H31N3O5 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.23 |
| IUPAC Name | tert-butyl 2-[1-[[4-(1-benzofuran-2-yl)-7-nitroisoquinolin-6-yl]methyl]piperidin-4-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1CCN(Cc2cc3c(-c4cc5ccccc5o4)cncc3cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C29H31N3O5/c1-29(2,3)37-28(33)12-19-8-10-31(11-9-19)18-22-13-23-21(14-25(22)32(34)35)16-30-17-24(23)27-15-20-6-4-5-7-26(20)36-27/h4-7,13-17,19H,8-12,18H2,1-3H3 |
| InChIKey | SHDCNDDCJQMSRW-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 98.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|