C29H32N2O5 — CID 122457465
tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]oxycyclohexyl]carbamate (PubChem CID 122457465) has the molecular formula C29H32N2O5 and a molecular weight of 488.58 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]oxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]oxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 122457465 |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-methoxyisoquinolin-6-yl]oxycyclohexyl]carbamate |
| SMILES | COc1cc(OC2CCC(NC(=O)OC(C)(C)C)CC2)cc2c(-c3cc4ccccc4o3)cncc12 |
| InChI | InChI=1S/C29H32N2O5/c1-29(2,3)36-28(32)31-19-9-11-20(12-10-19)34-21-14-22-23(26(15-21)33-4)16-30-17-24(22)27-13-18-7-5-6-8-25(18)35-27/h5-8,13-17,19-20H,9-12H2,1-4H3,(H,31,32) |
| InChIKey | WWBCTBDTUDGJGQ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |