C34H36N3O5+ — CID 122457713
tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-methoxy-1-pyridin-1-ium-1-ylisoquinolin-6-yl]oxycyclohexyl]carbamate (PubChem CID 122457713) has the molecular formula C34H36N3O5+ and a molecular weight of 566.68 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-methoxy-1-pyridin-1-ium-1-ylisoquinolin-6-yl]oxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-methoxy-1-pyridin-1-ium-1-ylisoquinolin-6-yl]oxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 122457713 |
| Molecular Formula | C34H36N3O5+ |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-methoxy-1-pyridin-1-ium-1-ylisoquinolin-6-yl]oxycyclohexyl]carbamate |
| SMILES | COc1cc(OC2CCC(NC(=O)OC(C)(C)C)CC2)cc2c(-c3cc4ccccc4o3)cnc(-[n+]3ccccc3)c12 |
| InChI | InChI=1S/C34H35N3O5/c1-34(2,3)42-33(38)36-23-12-14-24(15-13-23)40-25-19-26-27(29-18-22-10-6-7-11-28(22)41-29)21-35-32(31(26)30(20-25)39-4)37-16-8-5-9-17-37/h5-11,16-21,23-24H,12-15H2,1-4H3/p+1 |
| InChIKey | IHKBAFNGUVIFTF-UHFFFAOYSA-O |
| XLogP | 7.15 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|