C33H33ClN3O4+ — CID 122457749
tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-chloro-1-pyridin-1-ium-1-ylisoquinolin-6-yl]oxycyclohexyl]carbamate (PubChem CID 122457749) has the molecular formula C33H33ClN3O4+ and a molecular weight of 571.10 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-chloro-1-pyridin-1-ium-1-ylisoquinolin-6-yl]oxycyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-chloro-1-pyridin-1-ium-1-ylisoquinolin-6-yl]oxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 122457749 |
| Molecular Formula | C33H33ClN3O4+ |
| Molecular Weight | 571.10 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | tert-butyl N-[4-[4-(1-benzofuran-2-yl)-8-chloro-1-pyridin-1-ium-1-ylisoquinolin-6-yl]oxycyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Oc2cc(Cl)c3c(-[n+]4ccccc4)ncc(-c4cc5ccccc5o4)c3c2)CC1 |
| InChI | InChI=1S/C33H32ClN3O4/c1-33(2,3)41-32(38)36-22-11-13-23(14-12-22)39-24-18-25-26(29-17-21-9-5-6-10-28(21)40-29)20-35-31(30(25)27(34)19-24)37-15-7-4-8-16-37/h4-10,15-20,22-23H,11-14H2,1-3H3/p+1 |
| InChIKey | IREZLGVIRCZCOF-UHFFFAOYSA-O |
| XLogP | 7.79 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.10 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|