About 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane
4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane (PubChem CID 145136231) has the molecular formula C30H38ClN3O3
and a molecular weight of 524.11 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane.
Molecular Properties
| Compound Name | 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane |
| PubChem CID | 145136231 |
| Molecular Formula | C30H38ClN3O3 |
| Molecular Weight | 524.11 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(N)=O.Clc1cc(NC2CCCCC2)cc2c(-c3cc4ccccc4o3)cncc12 |
| InChI | InChI=1S/C23H21ClN2O.C5H11NO2.C2H6/c24-21-12-17(26-16-7-2-1-3-8-16)11-18-19(21)13-25-14-20(18)23-10-15-6-4-5-9-22(15)27-23;1-5(2,3)8-4(6)7;1-2/h4-6,9-14,16,26H,1-3,7-8H2;1-3H3,(H2,6,7);1-2H3 |
| InChIKey | BREPQFNZEZHJJO-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.11 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane?
The IUPAC name of 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane (CID 145136231) is 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane.
What is the SMILES notation for 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane?
The canonical SMILES for 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane is CC.CC(C)(C)OC(N)=O.Clc1cc(NC2CCCCC2)cc2c(-c3cc4ccccc4o3)cncc12.
What is the InChIKey of 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane?
The InChIKey is BREPQFNZEZHJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClN2O.C5H11NO2.C2H6/c24-21-12-17(26-16-7-2-1-3-8-16)11-18-19(21)13-25-14-20(18)23-10-15-6-4-5-9-22(15)27-23;1-5(2,3)8-4(6)7;1-2/h4-6,9-14,16,26H,1-3,7-8H2;1-3H3,(H2,6,7);1-2H3.
What are the key properties of 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane?
4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane has a molecular weight of 524.11 g/mol, XLogP of 8.95, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-benzofuran-2-yl)-8-chloro-N-cyclohexylisoquinolin-6-amine;tert-butyl carbamate;ethane is sourced from PubChem (CID 145136231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).