C24H23N3O2 — CID 122495279
4-amino-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]cyclohexane-1-carboxamide (PubChem CID 122495279) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 4-amino-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 122495279 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-amino-N-[4-(1-benzofuran-2-yl)isoquinolin-6-yl]cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2ccc3cncc(-c4cc5ccccc5o4)c3c2)CC1 |
| InChI | InChI=1S/C24H23N3O2/c25-18-8-5-15(6-9-18)24(28)27-19-10-7-17-13-26-14-21(20(17)12-19)23-11-16-3-1-2-4-22(16)29-23/h1-4,7,10-15,18H,5-6,8-9,25H2,(H,27,28) |
| InChIKey | IJHIRCMYZWJUCD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |